C22H26N2O4 — CID 4682883
2-[3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoylamino]benzamide (PubChem CID 4682883) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-[3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoylamino]benzamide.
| Compound Name | 2-[3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoylamino]benzamide |
|---|---|
| PubChem CID | 4682883 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-[3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoylamino]benzamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccccc2C(N)=O)ccc1OCCC(C)C |
| InChI | InChI=1S/C22H26N2O4/c1-15(2)12-13-28-19-10-8-16(14-20(19)27-3)9-11-21(25)24-18-7-5-4-6-17(18)22(23)26/h4-11,14-15H,12-13H2,1-3H3,(H2,23,26)(H,24,25) |
| InChIKey | WPWNPUIOIONEHJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|