C21H24INO3 — CID 4590678
N-(4-iodophenyl)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide (PubChem CID 4590678) has the molecular formula C21H24INO3 and a molecular weight of 465.33 g/mol. Its IUPAC name is N-(4-iodophenyl)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide.
| Compound Name | N-(4-iodophenyl)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4590678 |
| Molecular Formula | C21H24INO3 |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | N-(4-iodophenyl)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc(I)cc2)ccc1OCCC(C)C |
| InChI | InChI=1S/C21H24INO3/c1-15(2)12-13-26-19-10-4-16(14-20(19)25-3)5-11-21(24)23-18-8-6-17(22)7-9-18/h4-11,14-15H,12-13H2,1-3H3,(H,23,24) |
| InChIKey | FMMJOMSEVAMOAU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|