C18H26O5 — CID 11450118
ethyl (E)-3-[4-(3-hydroxyhexoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 11450118) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is ethyl (E)-3-[4-(3-hydroxyhexoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(3-hydroxyhexoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11450118 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | ethyl (E)-3-[4-(3-hydroxyhexoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | CCCC(O)CCOc1ccc(/C=C/C(=O)OCC)cc1OC |
| InChI | InChI=1S/C18H26O5/c1-4-6-15(19)11-12-23-16-9-7-14(13-17(16)21-3)8-10-18(20)22-5-2/h7-10,13,15,19H,4-6,11-12H2,1-3H3/b10-8+ |
| InChIKey | RUJDGXNXGWCBDC-CSKARUKUSA-N |
| XLogP | 3.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|