C29H25NO7 — CID 1180283
methyl 2-cyano-3-[3-methoxy-4-[3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyloxy]phenyl]prop-2-enoate (PubChem CID 1180283) has the molecular formula C29H25NO7 and a molecular weight of 499.52 g/mol. Its IUPAC name is methyl 2-cyano-3-[3-methoxy-4-[3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyloxy]phenyl]prop-2-enoate.
| Compound Name | methyl 2-cyano-3-[3-methoxy-4-[3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyloxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 1180283 |
| Molecular Formula | C29H25NO7 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | methyl 2-cyano-3-[3-methoxy-4-[3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyloxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)C(C#N)=Cc1ccc(OC(=O)C=Cc2ccc(OCc3ccccc3)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C29H25NO7/c1-33-26-16-20(9-12-24(26)36-19-21-7-5-4-6-8-21)11-14-28(31)37-25-13-10-22(17-27(25)34-2)15-23(18-30)29(32)35-3/h4-17H,19H2,1-3H3 |
| InChIKey | LSEIHLPIOWFQJJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 104.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|