C31H29ClN2O6 — CID 19185082
[4-[(E)-2-cyano-3-oxo-3-(propylamino)prop-1-enyl]-2-methoxyphenyl] (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate (PubChem CID 19185082) has the molecular formula C31H29ClN2O6 and a molecular weight of 561.03 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-oxo-3-(propylamino)prop-1-enyl]-2-methoxyphenyl] (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [4-[(E)-2-cyano-3-oxo-3-(propylamino)prop-1-enyl]-2-methoxyphenyl] (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19185082 |
| Molecular Formula | C31H29ClN2O6 |
| Molecular Weight | 561.03 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | [4-[(E)-2-cyano-3-oxo-3-(propylamino)prop-1-enyl]-2-methoxyphenyl] (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate |
| SMILES | CCCNC(=O)/C(C#N)=C/c1ccc(OC(=O)/C=C/c2ccc(OCc3ccc(Cl)cc3)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C31H29ClN2O6/c1-4-15-34-31(36)24(19-33)16-23-8-13-27(29(18-23)38-3)40-30(35)14-9-21-7-12-26(28(17-21)37-2)39-20-22-5-10-25(32)11-6-22/h5-14,16-18H,4,15,20H2,1-3H3,(H,34,36)/b14-9+,24-16+ |
| InChIKey | GRIAXSHBWWYTGK-UBXJNSBZSA-N |
| XLogP | 5.99 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.03 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|