C27H28N2O6 — CID 71967234
[4-[2-cyano-3-oxo-3-(prop-2-enylamino)prop-1-enyl]-2-methoxyphenyl] 3-(3,4-diethoxyphenyl)prop-2-enoate (PubChem CID 71967234) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is [4-[2-cyano-3-oxo-3-(prop-2-enylamino)prop-1-enyl]-2-methoxyphenyl] 3-(3,4-diethoxyphenyl)prop-2-enoate.
| Compound Name | [4-[2-cyano-3-oxo-3-(prop-2-enylamino)prop-1-enyl]-2-methoxyphenyl] 3-(3,4-diethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71967234 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [4-[2-cyano-3-oxo-3-(prop-2-enylamino)prop-1-enyl]-2-methoxyphenyl] 3-(3,4-diethoxyphenyl)prop-2-enoate |
| SMILES | C=CCNC(=O)C(C#N)=Cc1ccc(OC(=O)C=Cc2ccc(OCC)c(OCC)c2)c(OC)c1 |
| InChI | InChI=1S/C27H28N2O6/c1-5-14-29-27(31)21(18-28)15-20-9-12-23(24(17-20)32-4)35-26(30)13-10-19-8-11-22(33-6-2)25(16-19)34-7-3/h5,8-13,15-17H,1,6-7,14H2,2-4H3,(H,29,31) |
| InChIKey | DRKBCESCRAIWLJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|