C23H18Cl2N2O4 — CID 5056312
[4-[2-cyano-3-oxo-3-(prop-2-enylamino)prop-1-enyl]-2-methoxyphenyl] 3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 5056312) has the molecular formula C23H18Cl2N2O4 and a molecular weight of 457.31 g/mol. Its IUPAC name is [4-[2-cyano-3-oxo-3-(prop-2-enylamino)prop-1-enyl]-2-methoxyphenyl] 3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [4-[2-cyano-3-oxo-3-(prop-2-enylamino)prop-1-enyl]-2-methoxyphenyl] 3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5056312 |
| Molecular Formula | C23H18Cl2N2O4 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | [4-[2-cyano-3-oxo-3-(prop-2-enylamino)prop-1-enyl]-2-methoxyphenyl] 3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | C=CCNC(=O)C(C#N)=Cc1ccc(OC(=O)C=Cc2ccc(Cl)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C23H18Cl2N2O4/c1-3-10-27-23(29)17(14-26)11-16-5-8-20(21(13-16)30-2)31-22(28)9-6-15-4-7-18(24)19(25)12-15/h3-9,11-13H,1,10H2,2H3,(H,27,29) |
| InChIKey | AHMYAUJKTWSVLI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|