C24H22Cl2N2O4 — CID 19211827
[4-[(E)-3-(butylamino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 19211827) has the molecular formula C24H22Cl2N2O4 and a molecular weight of 473.36 g/mol. Its IUPAC name is [4-[(E)-3-(butylamino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [4-[(E)-3-(butylamino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19211827 |
| Molecular Formula | C24H22Cl2N2O4 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | [4-[(E)-3-(butylamino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | CCCCNC(=O)/C(C#N)=C/c1ccc(OC(=O)/C=C/c2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C24H22Cl2N2O4/c1-3-4-11-28-24(30)18(15-27)12-16-5-9-21(22(13-16)31-2)32-23(29)10-7-17-6-8-19(25)14-20(17)26/h5-10,12-14H,3-4,11H2,1-2H3,(H,28,30)/b10-7+,18-12+ |
| InChIKey | SYZDDFYINBFONU-WKZRCPIQSA-N |
| XLogP | 5.44 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|