C24H28BrN3O3S — CID 43961299
(E)-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 43961299) has the molecular formula C24H28BrN3O3S and a molecular weight of 518.48 g/mol. Its IUPAC name is (E)-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 43961299 |
| Molecular Formula | C24H28BrN3O3S |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | (E)-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | CCN(CC)CCN(C(=O)/C=C/c1ccc(OC)c(OC)c1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C24H28BrN3O3S/c1-5-27(6-2)13-14-28(24-26-19-10-9-18(25)16-22(19)32-24)23(29)12-8-17-7-11-20(30-3)21(15-17)31-4/h7-12,15-16H,5-6,13-14H2,1-4H3/b12-8+ |
| InChIKey | MKDXNVQVIMZOED-XYOKQWHBSA-N |
| XLogP | 5.46 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|