C25H30ClN3O4S — CID 74906928
N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 74906928) has the molecular formula C25H30ClN3O4S and a molecular weight of 504.05 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 74906928 |
| Molecular Formula | C25H30ClN3O4S |
| Molecular Weight | 504.05 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | CCN(CC)CCN(C(=O)C=Cc1cc(OC)c(OC)c(OC)c1)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C25H30ClN3O4S/c1-6-28(7-2)12-13-29(25-27-19-10-9-18(26)16-22(19)34-25)23(30)11-8-17-14-20(31-3)24(33-5)21(15-17)32-4/h8-11,14-16H,6-7,12-13H2,1-5H3 |
| InChIKey | SGRAXIBAIOMFJB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.05 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|