C19H19ClN4O3S2 — CID 74757662
N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-(5-nitrothiophen-2-yl)prop-2-enamide (PubChem CID 74757662) has the molecular formula C19H19ClN4O3S2 and a molecular weight of 450.97 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-(5-nitrothiophen-2-yl)prop-2-enamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-(5-nitrothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 74757662 |
| Molecular Formula | C19H19ClN4O3S2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| SMILES | CN(C)CCCN(C(=O)C=Cc1ccc([N+](=O)[O-])s1)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C19H19ClN4O3S2/c1-22(2)10-3-11-23(19-21-15-7-4-13(20)12-16(15)29-19)17(25)8-5-14-6-9-18(28-14)24(26)27/h4-9,12H,3,10-11H2,1-2H3 |
| InChIKey | BTVCHIMFTDEPEG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|