C21H25ClN3O2S2- — CID 53352734
(E)-N-[2-(diethylamino)ethyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide chloride (PubChem CID 53352734) has the molecular formula C21H25ClN3O2S2- and a molecular weight of 451.04 g/mol. Its IUPAC name is (E)-N-[2-(diethylamino)ethyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide chloride.
| Compound Name | (E)-N-[2-(diethylamino)ethyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide chloride |
|---|---|
| PubChem CID | 53352734 |
| Molecular Formula | C21H25ClN3O2S2- |
| Molecular Weight | 451.04 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | (E)-N-[2-(diethylamino)ethyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide chloride |
| SMILES | CCN(CC)CCN(C(=O)/C=C/c1cccs1)c1nc2ccc(OC)cc2s1.[Cl-] |
| InChI | InChI=1S/C21H25N3O2S2.ClH/c1-4-23(5-2)12-13-24(20(25)11-9-17-7-6-14-27-17)21-22-18-10-8-16(26-3)15-19(18)28-21;/h6-11,14-15H,4-5,12-13H2,1-3H3;1H/p-1/b11-9+; |
| InChIKey | WSRXYOBXHOCBFU-LBEJWNQZSA-M |
| XLogP | 1.76 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.04 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|