C21H24ClN3O2S2 — CID 41076375
(E)-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 41076375) has the molecular formula C21H24ClN3O2S2 and a molecular weight of 450.03 g/mol. Its IUPAC name is (E)-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 41076375 |
| Molecular Formula | C21H24ClN3O2S2 |
| Molecular Weight | 450.03 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | (E)-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCN(CC)CCN(C(=O)/C=C/c1cccs1)c1nc2c(OC)ccc(Cl)c2s1 |
| InChI | InChI=1S/C21H24ClN3O2S2/c1-4-24(5-2)12-13-25(18(26)11-8-15-7-6-14-28-15)21-23-19-17(27-3)10-9-16(22)20(19)29-21/h6-11,14H,4-5,12-13H2,1-3H3/b11-8+ |
| InChIKey | GKCSUANUKLCBRB-DHZHZOJOSA-N |
| XLogP | 5.41 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.03 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|