C21H25N3OS2 — CID 7511489
(E)-N-[2-(diethylamino)ethyl]-N-(4-methyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 7511489) has the molecular formula C21H25N3OS2 and a molecular weight of 399.59 g/mol. Its IUPAC name is (E)-N-[2-(diethylamino)ethyl]-N-(4-methyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-(diethylamino)ethyl]-N-(4-methyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 7511489 |
| Molecular Formula | C21H25N3OS2 |
| Molecular Weight | 399.59 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (E)-N-[2-(diethylamino)ethyl]-N-(4-methyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCN(CC)CCN(C(=O)/C=C/c1cccs1)c1nc2c(C)cccc2s1 |
| InChI | InChI=1S/C21H25N3OS2/c1-4-23(5-2)13-14-24(19(25)12-11-17-9-7-15-26-17)21-22-20-16(3)8-6-10-18(20)27-21/h6-12,15H,4-5,13-14H2,1-3H3/b12-11+ |
| InChIKey | YTPICVABWJTAGO-VAWYXSNFSA-N |
| XLogP | 5.05 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|