C21H17N3OS2 — CID 71962508
N-(4-methyl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 71962508) has the molecular formula C21H17N3OS2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-(4-methyl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(4-methyl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 71962508 |
| Molecular Formula | C21H17N3OS2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-(4-methyl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cc1cccc2sc(N(Cc3ccccn3)C(=O)C=Cc3cccs3)nc12 |
| InChI | InChI=1S/C21H17N3OS2/c1-15-6-4-9-18-20(15)23-21(27-18)24(14-16-7-2-3-12-22-16)19(25)11-10-17-8-5-13-26-17/h2-13H,14H2,1H3 |
| InChIKey | GQVJPLHLHLUFGP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|