C21H20N4OS2 — CID 44522243
N-(3-imidazol-1-ylpropyl)-N-(4-methyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 44522243) has the molecular formula C21H20N4OS2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-N-(4-methyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-N-(4-methyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 44522243 |
| Molecular Formula | C21H20N4OS2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-N-(4-methyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cc1cccc2sc(N(CCCn3ccnc3)C(=O)C=Cc3cccs3)nc12 |
| InChI | InChI=1S/C21H20N4OS2/c1-16-5-2-7-18-20(16)23-21(28-18)25(12-4-11-24-13-10-22-15-24)19(26)9-8-17-6-3-14-27-17/h2-3,5-10,13-15H,4,11-12H2,1H3 |
| InChIKey | AUUAGYVXUAJZTQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|