C20H17ClN4OS2 — CID 18589863
(E)-N-(6-chloro-1,3-benzothiazol-2-yl)-N-(3-imidazol-1-ylpropyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 18589863) has the molecular formula C20H17ClN4OS2 and a molecular weight of 428.97 g/mol. Its IUPAC name is (E)-N-(6-chloro-1,3-benzothiazol-2-yl)-N-(3-imidazol-1-ylpropyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(6-chloro-1,3-benzothiazol-2-yl)-N-(3-imidazol-1-ylpropyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 18589863 |
| Molecular Formula | C20H17ClN4OS2 |
| Molecular Weight | 428.97 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | (E)-N-(6-chloro-1,3-benzothiazol-2-yl)-N-(3-imidazol-1-ylpropyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)N(CCCn1ccnc1)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C20H17ClN4OS2/c21-15-4-6-17-18(13-15)28-20(23-17)25(10-2-9-24-11-8-22-14-24)19(26)7-5-16-3-1-12-27-16/h1,3-8,11-14H,2,9-10H2/b7-5+ |
| InChIKey | GLGUNFGMLLHVCO-FNORWQNLSA-N |
| XLogP | 5.34 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.97 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|