C20H22ClN3OS2 — CID 74768865
N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 74768865) has the molecular formula C20H22ClN3OS2 and a molecular weight of 420.00 g/mol. Its IUPAC name is N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 74768865 |
| Molecular Formula | C20H22ClN3OS2 |
| Molecular Weight | 420.00 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cc1cc(Cl)cc2sc(N(CCCN(C)C)C(=O)C=Cc3cccs3)nc12 |
| InChI | InChI=1S/C20H22ClN3OS2/c1-14-12-15(21)13-17-19(14)22-20(27-17)24(10-5-9-23(2)3)18(25)8-7-16-6-4-11-26-16/h4,6-8,11-13H,5,9-10H2,1-3H3 |
| InChIKey | WUBIXMRDFLQXMZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.00 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|