C18H18FN3OS2 — CID 7208043
(E)-N-[2-(dimethylamino)ethyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 7208043) has the molecular formula C18H18FN3OS2 and a molecular weight of 375.49 g/mol. Its IUPAC name is (E)-N-[2-(dimethylamino)ethyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-(dimethylamino)ethyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 7208043 |
| Molecular Formula | C18H18FN3OS2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (E)-N-[2-(dimethylamino)ethyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CN(C)CCN(C(=O)/C=C/c1cccs1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C18H18FN3OS2/c1-21(2)9-10-22(17(23)8-6-14-4-3-11-24-14)18-20-15-7-5-13(19)12-16(15)25-18/h3-8,11-12H,9-10H2,1-2H3/b8-6+ |
| InChIKey | ASLVZTFHSDBPEW-SOFGYWHQSA-N |
| XLogP | 4.10 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|