C20H23FN3OS2+ — CID 7511662
diethyl-[2-[(4-fluoro-1,3-benzothiazol-2-yl)-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]ethyl]azanium (PubChem CID 7511662) has the molecular formula C20H23FN3OS2+ and a molecular weight of 404.56 g/mol. Its IUPAC name is diethyl-[2-[(4-fluoro-1,3-benzothiazol-2-yl)-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]ethyl]azanium.
| Compound Name | diethyl-[2-[(4-fluoro-1,3-benzothiazol-2-yl)-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 7511662 |
| Molecular Formula | C20H23FN3OS2+ |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | diethyl-[2-[(4-fluoro-1,3-benzothiazol-2-yl)-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]ethyl]azanium |
| SMILES | CC[NH+](CC)CCN(C(=O)/C=C/c1cccs1)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C20H22FN3OS2/c1-3-23(4-2)12-13-24(18(25)11-10-15-7-6-14-26-15)20-22-19-16(21)8-5-9-17(19)27-20/h5-11,14H,3-4,12-13H2,1-2H3/p+1/b11-10+ |
| InChIKey | DDIYFZORKQUZFQ-ZHACJKMWSA-O |
| XLogP | 3.47 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|