5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid

C12H9NO3S — CID 71700391

IUPAC5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid
SMILESO=C(O)c1ncc(-c2ccc3c(c2)CCO3)s1
InChIInChI=1S/C12H9NO3S/c14-12(15)11-13-6-10(17-11)8-1-2-9-7(5-8)3-4-16-9/h1-2,5-6H,3-4H2,(H,14,15)
InChIKeyFXXWNDRLIOKJMJ-UHFFFAOYSA-N
MW247.27 g/mol
LogP2.44
Rot. Bonds2

About 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid

5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid (PubChem CID 71700391) has the molecular formula C12H9NO3S and a molecular weight of 247.27 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid.

Molecular Properties

Compound Name5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid
PubChem CID71700391
Molecular FormulaC12H9NO3S
Molecular Weight247.27 g/mol
Exact Mass247.03
IUPAC Name5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid
SMILESO=C(O)c1ncc(-c2ccc3c(c2)CCO3)s1
InChIInChI=1S/C12H9NO3S/c14-12(15)11-13-6-10(17-11)8-1-2-9-7(5-8)3-4-16-9/h1-2,5-6H,3-4H2,(H,14,15)
InChIKeyFXXWNDRLIOKJMJ-UHFFFAOYSA-N
XLogP2.44
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.27
LogP ≤ 52.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid (CID 71700391) is 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid is O=C(O)c1ncc(-c2ccc3c(c2)CCO3)s1.
What is the InChIKey of 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid?
The InChIKey is FXXWNDRLIOKJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3S/c14-12(15)11-13-6-10(17-11)8-1-2-9-7(5-8)3-4-16-9/h1-2,5-6H,3-4H2,(H,14,15).
What are the key properties of 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid?
5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid has a molecular weight of 247.27 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 71700391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).