5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid

C14H11NO3 — CID 54974551

IUPAC5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid
SMILESO=C(O)c1cncc(-c2ccc3c(c2)CCO3)c1
InChIInChI=1S/C14H11NO3/c16-14(17)12-6-11(7-15-8-12)9-1-2-13-10(5-9)3-4-18-13/h1-2,5-8H,3-4H2,(H,16,17)
InChIKeyMWENGLGTBLDDKQ-UHFFFAOYSA-N
MW241.25 g/mol
LogP2.38
Rot. Bonds2

About 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid

5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid (PubChem CID 54974551) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid
PubChem CID54974551
Molecular FormulaC14H11NO3
Molecular Weight241.25 g/mol
Exact Mass241.07
IUPAC Name5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid
SMILESO=C(O)c1cncc(-c2ccc3c(c2)CCO3)c1
InChIInChI=1S/C14H11NO3/c16-14(17)12-6-11(7-15-8-12)9-1-2-13-10(5-9)3-4-18-13/h1-2,5-8H,3-4H2,(H,16,17)
InChIKeyMWENGLGTBLDDKQ-UHFFFAOYSA-N
XLogP2.38
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.25
LogP ≤ 52.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid?
The IUPAC name of 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid (CID 54974551) is 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid.
What is the SMILES notation for 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid?
The canonical SMILES for 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid is O=C(O)c1cncc(-c2ccc3c(c2)CCO3)c1.
What is the InChIKey of 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid?
The InChIKey is MWENGLGTBLDDKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO3/c16-14(17)12-6-11(7-15-8-12)9-1-2-13-10(5-9)3-4-18-13/h1-2,5-8H,3-4H2,(H,16,17).
What are the key properties of 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid?
5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid has a molecular weight of 241.25 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid is sourced from PubChem (CID 54974551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).