C14H11NO3 — CID 54974551
5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid (PubChem CID 54974551) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid.
| Compound Name | 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 54974551 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-5-yl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(-c2ccc3c(c2)CCO3)c1 |
| InChI | InChI=1S/C14H11NO3/c16-14(17)12-6-11(7-15-8-12)9-1-2-13-10(5-9)3-4-18-13/h1-2,5-8H,3-4H2,(H,16,17) |
| InChIKey | MWENGLGTBLDDKQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |