C14H17NO3 — CID 111696980
3-hydroxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-5-methylbenzamide (PubChem CID 111696980) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-hydroxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-5-methylbenzamide.
| Compound Name | 3-hydroxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-5-methylbenzamide |
|---|---|
| PubChem CID | 111696980 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-hydroxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-5-methylbenzamide |
| SMILES | Cc1cc(O)cc(C(=O)N[C@@H]2C=C[C@H](CO)C2)c1 |
| InChI | InChI=1S/C14H17NO3/c1-9-4-11(7-13(17)5-9)14(18)15-12-3-2-10(6-12)8-16/h2-5,7,10,12,16-17H,6,8H2,1H3,(H,15,18)/t10-,12+/m0/s1 |
| InChIKey | JRNGHOOVMSYKBB-CMPLNLGQSA-N |
| XLogP | 1.37 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|