C17H16FNO3 — CID 111661565
5-(4-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]furan-2-carboxamide (PubChem CID 111661565) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]furan-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111661565 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]furan-2-carboxamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C17H16FNO3/c18-13-4-2-12(3-5-13)15-7-8-16(22-15)17(21)19-14-6-1-11(9-14)10-20/h1-8,11,14,20H,9-10H2,(H,19,21)/t11-,14+/m0/s1 |
| InChIKey | DCCXZAAZERVPDZ-SMDDNHRTSA-N |
| XLogP | 2.75 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|