C17H17FN2O2 — CID 111661805
7-fluoro-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-methylquinoline-4-carboxamide (PubChem CID 111661805) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is 7-fluoro-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-methylquinoline-4-carboxamide.
| Compound Name | 7-fluoro-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 111661805 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 7-fluoro-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H]2C=C[C@H](CO)C2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C17H17FN2O2/c1-10-6-15(14-5-3-12(18)8-16(14)19-10)17(22)20-13-4-2-11(7-13)9-21/h2-6,8,11,13,21H,7,9H2,1H3,(H,20,22)/t11-,13+/m0/s1 |
| InChIKey | GBCMGXFNUGVITK-WCQYABFASA-N |
| XLogP | 2.35 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|