C17H19FN2O3 — CID 111486130
7-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-2-methylquinoline-4-carboxamide (PubChem CID 111486130) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is 7-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-2-methylquinoline-4-carboxamide.
| Compound Name | 7-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 111486130 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 7-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCC2(O)CCOCC2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C17H19FN2O3/c1-11-8-14(13-3-2-12(18)9-15(13)20-11)16(21)19-10-17(22)4-6-23-7-5-17/h2-3,8-9,22H,4-7,10H2,1H3,(H,19,21) |
| InChIKey | ZRNOYGFLVAGRRS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |