C18H16BrNO5 — CID 39710609
7-bromo-N-(3,4,5-trimethoxyphenyl)-1-benzofuran-2-carboxamide (PubChem CID 39710609) has the molecular formula C18H16BrNO5 and a molecular weight of 406.23 g/mol. Its IUPAC name is 7-bromo-N-(3,4,5-trimethoxyphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 7-bromo-N-(3,4,5-trimethoxyphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 39710609 |
| Molecular Formula | C18H16BrNO5 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 7-bromo-N-(3,4,5-trimethoxyphenyl)-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc3cccc(Br)c3o2)cc(OC)c1OC |
| InChI | InChI=1S/C18H16BrNO5/c1-22-13-8-11(9-14(23-2)17(13)24-3)20-18(21)15-7-10-5-4-6-12(19)16(10)25-15/h4-9H,1-3H3,(H,20,21) |
| InChIKey | TWJUDISNZFXSKZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |