C10H14N2O6S — CID 119369320
(2R)-3-methyl-2-[(5-sulfamoylfuran-2-carbonyl)amino]butanoic acid (PubChem CID 119369320) has the molecular formula C10H14N2O6S and a molecular weight of 290.30 g/mol. Its IUPAC name is (2R)-3-methyl-2-[(5-sulfamoylfuran-2-carbonyl)amino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[(5-sulfamoylfuran-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119369320 |
| Molecular Formula | C10H14N2O6S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (2R)-3-methyl-2-[(5-sulfamoylfuran-2-carbonyl)amino]butanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc(S(N)(=O)=O)o1)C(=O)O |
| InChI | InChI=1S/C10H14N2O6S/c1-5(2)8(10(14)15)12-9(13)6-3-4-7(18-6)19(11,16)17/h3-5,8H,1-2H3,(H,12,13)(H,14,15)(H2,11,16,17)/t8-/m1/s1 |
| InChIKey | KKHPBIVYBJGEDZ-MRVPVSSYSA-N |
| XLogP | -0.23 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |