C12H18N2O6S — CID 43353960
2-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 43353960) has the molecular formula C12H18N2O6S and a molecular weight of 318.35 g/mol. Its IUPAC name is 2-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 43353960 |
| Molecular Formula | C12H18N2O6S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)c1ccc(S(=O)(=O)N(C)C)o1)C(=O)O |
| InChI | InChI=1S/C12H18N2O6S/c1-7(2)10(12(16)17)13-11(15)8-5-6-9(20-8)21(18,19)14(3)4/h5-7,10H,1-4H3,(H,13,15)(H,16,17) |
| InChIKey | JFNUBEARAPDSOM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |