C11H16N2O7S — CID 61243288
2-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]-4-hydroxybutanoic acid (PubChem CID 61243288) has the molecular formula C11H16N2O7S and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61243288 |
| Molecular Formula | C11H16N2O7S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]-4-hydroxybutanoic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NC(CCO)C(=O)O)o1 |
| InChI | InChI=1S/C11H16N2O7S/c1-13(2)21(18,19)9-4-3-8(20-9)10(15)12-7(5-6-14)11(16)17/h3-4,7,14H,5-6H2,1-2H3,(H,12,15)(H,16,17) |
| InChIKey | NJXFORAQKVOQHL-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |