C13H20N2O6S — CID 119192017
2-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]-2-methylpentanoic acid (PubChem CID 119192017) has the molecular formula C13H20N2O6S and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]-2-methylpentanoic acid.
| Compound Name | 2-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 119192017 |
| Molecular Formula | C13H20N2O6S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NC(=O)c1ccc(S(=O)(=O)N(C)C)o1)C(=O)O |
| InChI | InChI=1S/C13H20N2O6S/c1-5-8-13(2,12(17)18)14-11(16)9-6-7-10(21-9)22(19,20)15(3)4/h6-7H,5,8H2,1-4H3,(H,14,16)(H,17,18) |
| InChIKey | BOWSBWYHIXKHRP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |