C11H18N2O5S — CID 82725711
5-(dimethylsulfamoyl)-N-[(2-methylpropan-2-yl)oxy]furan-2-carboxamide (PubChem CID 82725711) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-[(2-methylpropan-2-yl)oxy]furan-2-carboxamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-[(2-methylpropan-2-yl)oxy]furan-2-carboxamide |
|---|---|
| PubChem CID | 82725711 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-[(2-methylpropan-2-yl)oxy]furan-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NOC(C)(C)C)o1 |
| InChI | InChI=1S/C11H18N2O5S/c1-11(2,3)18-12-10(14)8-6-7-9(17-8)19(15,16)13(4)5/h6-7H,1-5H3,(H,12,14) |
| InChIKey | FGDFIAVUEUFUFP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|