C13H20N2O4S — CID 114550104
5-(dimethylsulfamoyl)-N-(3-methylcyclopentyl)furan-2-carboxamide (PubChem CID 114550104) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-(3-methylcyclopentyl)furan-2-carboxamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-(3-methylcyclopentyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 114550104 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-(3-methylcyclopentyl)furan-2-carboxamide |
| SMILES | CC1CCC(NC(=O)c2ccc(S(=O)(=O)N(C)C)o2)C1 |
| InChI | InChI=1S/C13H20N2O4S/c1-9-4-5-10(8-9)14-13(16)11-6-7-12(19-11)20(17,18)15(2)3/h6-7,9-10H,4-5,8H2,1-3H3,(H,14,16) |
| InChIKey | IZWPRVUMNOORQJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |