C17H20N2O6S — CID 119254007
2-[4-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]phenyl]-2-methylpropanoic acid (PubChem CID 119254007) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-[4-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119254007 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-[4-[[5-(dimethylsulfamoyl)furan-2-carbonyl]amino]phenyl]-2-methylpropanoic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2ccc(C(C)(C)C(=O)O)cc2)o1 |
| InChI | InChI=1S/C17H20N2O6S/c1-17(2,16(21)22)11-5-7-12(8-6-11)18-15(20)13-9-10-14(25-13)26(23,24)19(3)4/h5-10H,1-4H3,(H,18,20)(H,21,22) |
| InChIKey | ZWYMBXJCMLFHHM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |