C15H21ClN2O5S — CID 97315366
(2R)-2-[[4-chloro-3-(dimethylsulfamoyl)benzoyl]amino]-2-methylpentanoic acid (PubChem CID 97315366) has the molecular formula C15H21ClN2O5S and a molecular weight of 376.86 g/mol. Its IUPAC name is (2R)-2-[[4-chloro-3-(dimethylsulfamoyl)benzoyl]amino]-2-methylpentanoic acid.
| Compound Name | (2R)-2-[[4-chloro-3-(dimethylsulfamoyl)benzoyl]amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 97315366 |
| Molecular Formula | C15H21ClN2O5S |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (2R)-2-[[4-chloro-3-(dimethylsulfamoyl)benzoyl]amino]-2-methylpentanoic acid |
| SMILES | CCC[C@@](C)(NC(=O)c1ccc(Cl)c(S(=O)(=O)N(C)C)c1)C(=O)O |
| InChI | InChI=1S/C15H21ClN2O5S/c1-5-8-15(2,14(20)21)17-13(19)10-6-7-11(16)12(9-10)24(22,23)18(3)4/h6-7,9H,5,8H2,1-4H3,(H,17,19)(H,20,21)/t15-/m1/s1 |
| InChIKey | UJOUEOIVWVYOJA-OAHLLOKOSA-N |
| XLogP | 1.96 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |