C14H17Cl2NO4 — CID 43619029
2-[(3,5-dichloro-4-methoxybenzoyl)amino]-2-methylpentanoic acid (PubChem CID 43619029) has the molecular formula C14H17Cl2NO4 and a molecular weight of 334.20 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-methoxybenzoyl)amino]-2-methylpentanoic acid.
| Compound Name | 2-[(3,5-dichloro-4-methoxybenzoyl)amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 43619029 |
| Molecular Formula | C14H17Cl2NO4 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-[(3,5-dichloro-4-methoxybenzoyl)amino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NC(=O)c1cc(Cl)c(OC)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C14H17Cl2NO4/c1-4-5-14(2,13(19)20)17-12(18)8-6-9(15)11(21-3)10(16)7-8/h6-7H,4-5H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | HADRUVPHYLGEGU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |