C12H14Cl2N2O3 — CID 82832526
2-[(4-amino-3,5-dichlorobenzoyl)amino]-2-methylbutanoic acid (PubChem CID 82832526) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 2-[(4-amino-3,5-dichlorobenzoyl)amino]-2-methylbutanoic acid.
| Compound Name | 2-[(4-amino-3,5-dichlorobenzoyl)amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 82832526 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-[(4-amino-3,5-dichlorobenzoyl)amino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NC(=O)c1cc(Cl)c(N)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H14Cl2N2O3/c1-3-12(2,11(18)19)16-10(17)6-4-7(13)9(15)8(14)5-6/h4-5H,3,15H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | NGQYSDQAEMNMLV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|