C11H18N2O5S — CID 112548201
5-(dimethylsulfamoyl)-N-(1-hydroxypropan-2-yl)-N-methylfuran-2-carboxamide (PubChem CID 112548201) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-(1-hydroxypropan-2-yl)-N-methylfuran-2-carboxamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-(1-hydroxypropan-2-yl)-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 112548201 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-(1-hydroxypropan-2-yl)-N-methylfuran-2-carboxamide |
| SMILES | CC(CO)N(C)C(=O)c1ccc(S(=O)(=O)N(C)C)o1 |
| InChI | InChI=1S/C11H18N2O5S/c1-8(7-14)13(4)11(15)9-5-6-10(18-9)19(16,17)12(2)3/h5-6,8,14H,7H2,1-4H3 |
| InChIKey | YBUHJXKPHFVWAR-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |