C12H20N2O5S — CID 43573514
5-(dimethylsulfamoyl)-N-(2-hydroxyethyl)-N-propan-2-ylfuran-2-carboxamide (PubChem CID 43573514) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-(2-hydroxyethyl)-N-propan-2-ylfuran-2-carboxamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-(2-hydroxyethyl)-N-propan-2-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 43573514 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-(2-hydroxyethyl)-N-propan-2-ylfuran-2-carboxamide |
| SMILES | CC(C)N(CCO)C(=O)c1ccc(S(=O)(=O)N(C)C)o1 |
| InChI | InChI=1S/C12H20N2O5S/c1-9(2)14(7-8-15)12(16)10-5-6-11(19-10)20(17,18)13(3)4/h5-6,9,15H,7-8H2,1-4H3 |
| InChIKey | QHUYECNHZMVWSD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |