C13H18N4O2 — CID 43430673
5-(diethylaminomethyl)-N-(1H-pyrazol-4-yl)furan-2-carboxamide (PubChem CID 43430673) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-(diethylaminomethyl)-N-(1H-pyrazol-4-yl)furan-2-carboxamide.
| Compound Name | 5-(diethylaminomethyl)-N-(1H-pyrazol-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 43430673 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5-(diethylaminomethyl)-N-(1H-pyrazol-4-yl)furan-2-carboxamide |
| SMILES | CCN(CC)Cc1ccc(C(=O)Nc2cn[nH]c2)o1 |
| InChI | InChI=1S/C13H18N4O2/c1-3-17(4-2)9-11-5-6-12(19-11)13(18)16-10-7-14-15-8-10/h5-8H,3-4,9H2,1-2H3,(H,14,15)(H,16,18) |
| InChIKey | NWJVMNGGSFRWAQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |