C26H37NO3 — CID 93187587
5-[5-[[[(2S)-butan-2-yl]-[(2-methoxyphenyl)methyl]amino]methyl]furan-2-yl]nona-1,8-dien-5-ol (PubChem CID 93187587) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is 5-[5-[[[(2S)-butan-2-yl]-[(2-methoxyphenyl)methyl]amino]methyl]furan-2-yl]nona-1,8-dien-5-ol.
| Compound Name | 5-[5-[[[(2S)-butan-2-yl]-[(2-methoxyphenyl)methyl]amino]methyl]furan-2-yl]nona-1,8-dien-5-ol |
|---|---|
| PubChem CID | 93187587 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 5-[5-[[[(2S)-butan-2-yl]-[(2-methoxyphenyl)methyl]amino]methyl]furan-2-yl]nona-1,8-dien-5-ol |
| SMILES | C=CCCC(O)(CCC=C)c1ccc(CN(Cc2ccccc2OC)[C@@H](C)CC)o1 |
| InChI | InChI=1S/C26H37NO3/c1-6-9-17-26(28,18-10-7-2)25-16-15-23(30-25)20-27(21(4)8-3)19-22-13-11-12-14-24(22)29-5/h6-7,11-16,21,28H,1-2,8-10,17-20H2,3-5H3/t21-/m0/s1 |
| InChIKey | GKBAIEKIPLIHPO-NRFANRHFSA-N |
| XLogP | 6.21 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|