C21H33NO2S — CID 46015945
4-[5-[[butan-2-yl(thiophen-2-ylmethyl)amino]methyl]furan-2-yl]heptan-4-ol (PubChem CID 46015945) has the molecular formula C21H33NO2S and a molecular weight of 363.57 g/mol. Its IUPAC name is 4-[5-[[butan-2-yl(thiophen-2-ylmethyl)amino]methyl]furan-2-yl]heptan-4-ol.
| Compound Name | 4-[5-[[butan-2-yl(thiophen-2-ylmethyl)amino]methyl]furan-2-yl]heptan-4-ol |
|---|---|
| PubChem CID | 46015945 |
| Molecular Formula | C21H33NO2S |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 4-[5-[[butan-2-yl(thiophen-2-ylmethyl)amino]methyl]furan-2-yl]heptan-4-ol |
| SMILES | CCCC(O)(CCC)c1ccc(CN(Cc2cccs2)C(C)CC)o1 |
| InChI | InChI=1S/C21H33NO2S/c1-5-12-21(23,13-6-2)20-11-10-18(24-20)15-22(17(4)7-3)16-19-9-8-14-25-19/h8-11,14,17,23H,5-7,12-13,15-16H2,1-4H3 |
| InChIKey | NZXPVAIJXIVGNI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |