C26H35NO3 — CID 93182685
5-[5-[[benzyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]furan-2-yl]nona-1,8-dien-5-ol (PubChem CID 93182685) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is 5-[5-[[benzyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]furan-2-yl]nona-1,8-dien-5-ol.
| Compound Name | 5-[5-[[benzyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]furan-2-yl]nona-1,8-dien-5-ol |
|---|---|
| PubChem CID | 93182685 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 5-[5-[[benzyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]furan-2-yl]nona-1,8-dien-5-ol |
| SMILES | C=CCCC(O)(CCC=C)c1ccc(CN(Cc2ccccc2)C[C@H]2CCCO2)o1 |
| InChI | InChI=1S/C26H35NO3/c1-3-5-16-26(28,17-6-4-2)25-15-14-24(30-25)21-27(20-23-13-10-18-29-23)19-22-11-8-7-9-12-22/h3-4,7-9,11-12,14-15,23,28H,1-2,5-6,10,13,16-21H2/t23-/m1/s1 |
| InChIKey | WPVJFYFMNOSBTK-HSZRJFAPSA-N |
| XLogP | 5.58 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|