C24H33NO3S — CID 93193958
5-[5-[[[(2R)-oxolan-2-yl]methyl-(thiophen-3-ylmethyl)amino]methyl]furan-2-yl]nona-1,8-dien-5-ol (PubChem CID 93193958) has the molecular formula C24H33NO3S and a molecular weight of 415.60 g/mol. Its IUPAC name is 5-[5-[[[(2R)-oxolan-2-yl]methyl-(thiophen-3-ylmethyl)amino]methyl]furan-2-yl]nona-1,8-dien-5-ol.
| Compound Name | 5-[5-[[[(2R)-oxolan-2-yl]methyl-(thiophen-3-ylmethyl)amino]methyl]furan-2-yl]nona-1,8-dien-5-ol |
|---|---|
| PubChem CID | 93193958 |
| Molecular Formula | C24H33NO3S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 5-[5-[[[(2R)-oxolan-2-yl]methyl-(thiophen-3-ylmethyl)amino]methyl]furan-2-yl]nona-1,8-dien-5-ol |
| SMILES | C=CCCC(O)(CCC=C)c1ccc(CN(Cc2ccsc2)C[C@H]2CCCO2)o1 |
| InChI | InChI=1S/C24H33NO3S/c1-3-5-12-24(26,13-6-4-2)23-10-9-22(28-23)18-25(16-20-11-15-29-19-20)17-21-8-7-14-27-21/h3-4,9-11,15,19,21,26H,1-2,5-8,12-14,16-18H2/t21-/m1/s1 |
| InChIKey | DOQYWYSSOPUGLT-OAQYLSRUSA-N |
| XLogP | 5.64 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|