C25H35NO2 — CID 46017678
5-[5-[[(4-methylphenyl)methyl-propylamino]methyl]furan-2-yl]nona-1,8-dien-5-ol (PubChem CID 46017678) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is 5-[5-[[(4-methylphenyl)methyl-propylamino]methyl]furan-2-yl]nona-1,8-dien-5-ol.
| Compound Name | 5-[5-[[(4-methylphenyl)methyl-propylamino]methyl]furan-2-yl]nona-1,8-dien-5-ol |
|---|---|
| PubChem CID | 46017678 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | 5-[5-[[(4-methylphenyl)methyl-propylamino]methyl]furan-2-yl]nona-1,8-dien-5-ol |
| SMILES | C=CCCC(O)(CCC=C)c1ccc(CN(CCC)Cc2ccc(C)cc2)o1 |
| InChI | InChI=1S/C25H35NO2/c1-5-8-16-25(27,17-9-6-2)24-15-14-23(28-24)20-26(18-7-3)19-22-12-10-21(4)11-13-22/h5-6,10-15,27H,1-2,7-9,16-20H2,3-4H3 |
| InChIKey | QHEMMKCYACDHHD-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|