C21H27NO3 — CID 42839319
4-[5-[[cyclopropyl-[(5-methylfuran-2-yl)methyl]amino]methyl]furan-2-yl]hepta-1,6-dien-4-ol (PubChem CID 42839319) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 4-[5-[[cyclopropyl-[(5-methylfuran-2-yl)methyl]amino]methyl]furan-2-yl]hepta-1,6-dien-4-ol.
| Compound Name | 4-[5-[[cyclopropyl-[(5-methylfuran-2-yl)methyl]amino]methyl]furan-2-yl]hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 42839319 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 4-[5-[[cyclopropyl-[(5-methylfuran-2-yl)methyl]amino]methyl]furan-2-yl]hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(CC=C)c1ccc(CN(Cc2ccc(C)o2)C2CC2)o1 |
| InChI | InChI=1S/C21H27NO3/c1-4-12-21(23,13-5-2)20-11-10-19(25-20)15-22(17-7-8-17)14-18-9-6-16(3)24-18/h4-6,9-11,17,23H,1-2,7-8,12-15H2,3H3 |
| InChIKey | LMUFNVFKRRGUPA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|