C14H20ClNO2 — CID 63665475
3-chloro-N-cyclopropyl-2,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]propanamide (PubChem CID 63665475) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 3-chloro-N-cyclopropyl-2,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]propanamide.
| Compound Name | 3-chloro-N-cyclopropyl-2,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 63665475 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-chloro-N-cyclopropyl-2,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]propanamide |
| SMILES | Cc1ccc(CN(C(=O)C(C)(C)CCl)C2CC2)o1 |
| InChI | InChI=1S/C14H20ClNO2/c1-10-4-7-12(18-10)8-16(11-5-6-11)13(17)14(2,3)9-15/h4,7,11H,5-6,8-9H2,1-3H3 |
| InChIKey | MIUIMUJPFOOLRF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|