C19H22ClNO4 — CID 3281618
N-(1,3-benzodioxol-5-ylmethyl)-3-chloro-2,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]propanamide (PubChem CID 3281618) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-chloro-2,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-chloro-2,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 3281618 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-chloro-2,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]propanamide |
| SMILES | Cc1ccc(CN(Cc2ccc3c(c2)OCO3)C(=O)C(C)(C)CCl)o1 |
| InChI | InChI=1S/C19H22ClNO4/c1-13-4-6-15(25-13)10-21(18(22)19(2,3)11-20)9-14-5-7-16-17(8-14)24-12-23-16/h4-8H,9-12H2,1-3H3 |
| InChIKey | FXGPCJQIEJHZTR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|