C22H30N2O5 — CID 26482215
3-[(2S)-2-hydroxy-3-[4-(3-oxobutyl)phenoxy]propyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 26482215) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is 3-[(2S)-2-hydroxy-3-[4-(3-oxobutyl)phenoxy]propyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(2S)-2-hydroxy-3-[4-(3-oxobutyl)phenoxy]propyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26482215 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 3-[(2S)-2-hydroxy-3-[4-(3-oxobutyl)phenoxy]propyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(=O)CCc1ccc(OC[C@@H](O)CN2C(=O)NC3(CCC(C)CC3)C2=O)cc1 |
| InChI | InChI=1S/C22H30N2O5/c1-15-9-11-22(12-10-15)20(27)24(21(28)23-22)13-18(26)14-29-19-7-5-17(6-8-19)4-3-16(2)25/h5-8,15,18,26H,3-4,9-14H2,1-2H3,(H,23,28)/t15?,18-,22?/m0/s1 |
| InChIKey | VXHOUGRVHUBZER-TUAABQIMSA-N |
| XLogP | 2.45 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|