C23H28FNO3 — CID 124839148
4-[4-[(2R)-3-[(2S)-2-(4-fluorophenyl)pyrrolidin-1-yl]-2-hydroxypropoxy]phenyl]butan-2-one (PubChem CID 124839148) has the molecular formula C23H28FNO3 and a molecular weight of 385.48 g/mol. Its IUPAC name is 4-[4-[(2R)-3-[(2S)-2-(4-fluorophenyl)pyrrolidin-1-yl]-2-hydroxypropoxy]phenyl]butan-2-one.
| Compound Name | 4-[4-[(2R)-3-[(2S)-2-(4-fluorophenyl)pyrrolidin-1-yl]-2-hydroxypropoxy]phenyl]butan-2-one |
|---|---|
| PubChem CID | 124839148 |
| Molecular Formula | C23H28FNO3 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 4-[4-[(2R)-3-[(2S)-2-(4-fluorophenyl)pyrrolidin-1-yl]-2-hydroxypropoxy]phenyl]butan-2-one |
| SMILES | CC(=O)CCc1ccc(OC[C@H](O)CN2CCC[C@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H28FNO3/c1-17(26)4-5-18-6-12-22(13-7-18)28-16-21(27)15-25-14-2-3-23(25)19-8-10-20(24)11-9-19/h6-13,21,23,27H,2-5,14-16H2,1H3/t21-,23+/m1/s1 |
| InChIKey | ORFXYXDFNCJWSI-GGAORHGYSA-N |
| XLogP | 3.92 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |